C13H12N2O5 — CID 131861754
2-formamido-2-(1H-indol-3-ylmethyl)propanedioic acid (PubChem CID 131861754) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-formamido-2-(1H-indol-3-ylmethyl)propanedioic acid.
| Compound Name | 2-formamido-2-(1H-indol-3-ylmethyl)propanedioic acid |
|---|---|
| PubChem CID | 131861754 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-formamido-2-(1H-indol-3-ylmethyl)propanedioic acid |
| SMILES | O=CNC(Cc1c[nH]c2ccccc12)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H12N2O5/c16-7-15-13(11(17)18,12(19)20)5-8-6-14-10-4-2-1-3-9(8)10/h1-4,6-7,14H,5H2,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | GSAQZOWFWRDMBH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|