C20H20N2O2S — CID 88778493
(2S)-2-(1H-indol-3-ylmethyl)-2-(methylamino)-4-phenyl-3-sulfanylidenebutanoic acid (PubChem CID 88778493) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (2S)-2-(1H-indol-3-ylmethyl)-2-(methylamino)-4-phenyl-3-sulfanylidenebutanoic acid.
| Compound Name | (2S)-2-(1H-indol-3-ylmethyl)-2-(methylamino)-4-phenyl-3-sulfanylidenebutanoic acid |
|---|---|
| PubChem CID | 88778493 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (2S)-2-(1H-indol-3-ylmethyl)-2-(methylamino)-4-phenyl-3-sulfanylidenebutanoic acid |
| SMILES | CN[C@@](Cc1c[nH]c2ccccc12)(C(=O)O)C(=S)Cc1ccccc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-21-20(19(23)24,18(25)11-14-7-3-2-4-8-14)12-15-13-22-17-10-6-5-9-16(15)17/h2-10,13,21-22H,11-12H2,1H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | XFOBUCXCNBPJAU-HXUWFJFHSA-N |
| XLogP | 3.37 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|