C15H21N2O2+ — CID 91357862
[2-carboxy-1-(1H-indol-3-yl)propan-2-yl]-trimethylazanium (PubChem CID 91357862) has the molecular formula C15H21N2O2+ and a molecular weight of 261.34 g/mol. Its IUPAC name is [2-carboxy-1-(1H-indol-3-yl)propan-2-yl]-trimethylazanium.
| Compound Name | [2-carboxy-1-(1H-indol-3-yl)propan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 91357862 |
| Molecular Formula | C15H21N2O2+ |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | [2-carboxy-1-(1H-indol-3-yl)propan-2-yl]-trimethylazanium |
| SMILES | CC(Cc1c[nH]c2ccccc12)(C(=O)O)[N+](C)(C)C |
| InChI | InChI=1S/C15H20N2O2/c1-15(14(18)19,17(2,3)4)9-11-10-16-13-8-6-5-7-12(11)13/h5-8,10,16H,9H2,1-4H3/p+1 |
| InChIKey | AFXGYLXCXLIBQL-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|