C12H16N2O2 — CID 172578399
1-(dimethylamino)-2-(1H-indol-3-yl)ethane-1,1-diol (PubChem CID 172578399) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-(dimethylamino)-2-(1H-indol-3-yl)ethane-1,1-diol.
| Compound Name | 1-(dimethylamino)-2-(1H-indol-3-yl)ethane-1,1-diol |
|---|---|
| PubChem CID | 172578399 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-(dimethylamino)-2-(1H-indol-3-yl)ethane-1,1-diol |
| SMILES | CN(C)C(O)(O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H16N2O2/c1-14(2)12(15,16)7-9-8-13-11-6-4-3-5-10(9)11/h3-6,8,13,15-16H,7H2,1-2H3 |
| InChIKey | ZKCUPAZEPUNZNE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|