C13H17BN2O3 — CID 156836272
CID 156836272 (PubChem CID 156836272) has the molecular formula C13H17BN2O3 and a molecular weight of 260.10 g/mol.
| Compound Name | CID 156836272 |
|---|---|
| PubChem CID | 156836272 |
| Molecular Formula | C13H17BN2O3 |
| Molecular Weight | 260.10 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | — |
| SMILES | [B]C(C)(O)N(C)C(O)(O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H17BN2O3/c1-12(14,17)16(2)13(18,19)7-9-8-15-11-6-4-3-5-10(9)11/h3-6,8,15,17-19H,7H2,1-2H3 |
| InChIKey | PDMCZMKVHMEEGD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 79.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.10 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|