C13H18N2O7 — CID 156836178
[1,1-dihydroxyethyl-[1,1-dihydroxy-2-(1H-indol-3-yl)ethyl]amino]methanetriol (PubChem CID 156836178) has the molecular formula C13H18N2O7 and a molecular weight of 314.29 g/mol. Its IUPAC name is [1,1-dihydroxyethyl-[1,1-dihydroxy-2-(1H-indol-3-yl)ethyl]amino]methanetriol.
| Compound Name | [1,1-dihydroxyethyl-[1,1-dihydroxy-2-(1H-indol-3-yl)ethyl]amino]methanetriol |
|---|---|
| PubChem CID | 156836178 |
| Molecular Formula | C13H18N2O7 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [1,1-dihydroxyethyl-[1,1-dihydroxy-2-(1H-indol-3-yl)ethyl]amino]methanetriol |
| SMILES | CC(O)(O)N(C(O)(O)O)C(O)(O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H18N2O7/c1-11(16,17)15(13(20,21)22)12(18,19)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,14,16-22H,6H2,1H3 |
| InChIKey | IENNWFCKTGVOPP-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 160.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|