About CID 156836279
CID 156836279 (PubChem CID 156836279) has the molecular formula C13H17BN2O
and a molecular weight of 228.10 g/mol.
Molecular Properties
| Compound Name | CID 156836279 |
| PubChem CID | 156836279 |
| Molecular Formula | C13H17BN2O |
| Molecular Weight | 228.10 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | — |
| SMILES | [B]C(C)(O)N(C)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H17BN2O/c1-13(14,17)16(2)8-7-10-9-15-12-6-4-3-5-11(10)12/h3-6,9,15,17H,7-8H2,1-2H3 |
| InChIKey | XSXUAMWBMOEEID-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.10 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 156836279 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156836279?
The IUPAC name of CID 156836279 (CID 156836279) is not available.
What is the SMILES notation for CID 156836279?
The canonical SMILES for CID 156836279 is [B]C(C)(O)N(C)CCc1c[nH]c2ccccc12.
What is the InChIKey of CID 156836279?
The InChIKey is XSXUAMWBMOEEID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BN2O/c1-13(14,17)16(2)8-7-10-9-15-12-6-4-3-5-11(10)12/h3-6,9,15,17H,7-8H2,1-2H3.
What are the key properties of CID 156836279?
CID 156836279 has a molecular weight of 228.10 g/mol, XLogP of 1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156836279 is sourced from PubChem (CID 156836279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).