C15H22N2O — CID 71261395
[2-(1H-indol-3-yl)ethyl-(2-methylpropyl)amino]methanol (PubChem CID 71261395) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)ethyl-(2-methylpropyl)amino]methanol.
| Compound Name | [2-(1H-indol-3-yl)ethyl-(2-methylpropyl)amino]methanol |
|---|---|
| PubChem CID | 71261395 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | [2-(1H-indol-3-yl)ethyl-(2-methylpropyl)amino]methanol |
| SMILES | CC(C)CN(CO)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H22N2O/c1-12(2)10-17(11-18)8-7-13-9-16-15-6-4-3-5-14(13)15/h3-6,9,12,16,18H,7-8,10-11H2,1-2H3 |
| InChIKey | KMOWQGCDMSYFRR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|