C16H17NO6 — CID 10313865
2-ethoxycarbonyl-2-(1H-indol-3-ylmethyl)butanedioic acid (PubChem CID 10313865) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-(1H-indol-3-ylmethyl)butanedioic acid.
| Compound Name | 2-ethoxycarbonyl-2-(1H-indol-3-ylmethyl)butanedioic acid |
|---|---|
| PubChem CID | 10313865 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-ethoxycarbonyl-2-(1H-indol-3-ylmethyl)butanedioic acid |
| SMILES | CCOC(=O)C(CC(=O)O)(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H17NO6/c1-2-23-15(22)16(14(20)21,8-13(18)19)7-10-9-17-12-6-4-3-5-11(10)12/h3-6,9,17H,2,7-8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | MVCREEZJSDBDIZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|