C60H70Cl2N6O10 — CID 57031490
bis[2-[[2-[(2-chlorocyclohexyl)oxycarbonylamino]-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-3-phenylpropyl] butanedioate (PubChem CID 57031490) has the molecular formula C60H70Cl2N6O10 and a molecular weight of 1106.16 g/mol. Its IUPAC name is bis[2-[[2-[(2-chlorocyclohexyl)oxycarbonylamino]-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-3-phenylpropyl] butanedioate.
| Compound Name | bis[2-[[2-[(2-chlorocyclohexyl)oxycarbonylamino]-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-3-phenylpropyl] butanedioate |
|---|---|
| PubChem CID | 57031490 |
| Molecular Formula | C60H70Cl2N6O10 |
| Molecular Weight | 1106.16 g/mol |
| Exact Mass | 1104.45 |
| IUPAC Name | bis[2-[[2-[(2-chlorocyclohexyl)oxycarbonylamino]-3-(1H-indol-3-yl)-2-methylpropanoyl]amino]-3-phenylpropyl] butanedioate |
| SMILES | CC(Cc1c[nH]c2ccccc12)(NC(=O)OC1CCCCC1Cl)C(=O)NC(COC(=O)CCC(=O)OCC(Cc1ccccc1)NC(=O)C(C)(Cc1c[nH]c2ccccc12)NC(=O)OC1CCCCC1Cl)Cc1ccccc1 |
| InChI | InChI=1S/C60H70Cl2N6O10/c1-59(33-41-35-63-49-25-13-9-21-45(41)49,67-57(73)77-51-27-15-11-23-47(51)61)55(71)65-43(31-39-17-5-3-6-18-39)37-75-53(69)29-30-54(70)76-38-44(32-40-19-7-4-8-20-40)66-56(72)60(2,34-42-36-64-50-26-14-10-22-46(42)50)68-58(74)78-52-28-16-12-24-48(52)62/h3-10,13-14,17-22,25-26,35-36,43-44,47-48,51-52,63-64H,11-12,15-16,23-24,27-34,37-38H2,1-2H3,(H,65,71)(H,66,72)(H,67,73)(H,68,74) |
| InChIKey | KOLMXPNZPKGYRD-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 219.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1106.16 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|