C28H34ClN3O4 — CID 67828385
[2-[(2-chlorocyclohexyl)methyl]-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl] carbamate (PubChem CID 67828385) has the molecular formula C28H34ClN3O4 and a molecular weight of 512.05 g/mol. Its IUPAC name is [2-[(2-chlorocyclohexyl)methyl]-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl] carbamate.
| Compound Name | [2-[(2-chlorocyclohexyl)methyl]-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 67828385 |
| Molecular Formula | C28H34ClN3O4 |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | [2-[(2-chlorocyclohexyl)methyl]-1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl] carbamate |
| SMILES | NC(=O)OC(Cc1c[nH]c2ccccc12)(CC1CCCCC1Cl)C(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C28H34ClN3O4/c29-24-12-6-4-10-20(24)15-28(36-27(30)35,16-21-17-31-25-13-7-5-11-23(21)25)26(34)32-22(18-33)14-19-8-2-1-3-9-19/h1-3,5,7-9,11,13,17,20,22,24,31,33H,4,6,10,12,14-16,18H2,(H2,30,35)(H,32,34) |
| InChIKey | MLXNOJQCJPEMOB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|