C33H47N3O4 — CID 67828397
[1-[(4-hydroxy-1-phenylbutan-2-yl)amino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl] N-decan-2-ylcarbamate (PubChem CID 67828397) has the molecular formula C33H47N3O4 and a molecular weight of 549.76 g/mol. Its IUPAC name is [1-[(4-hydroxy-1-phenylbutan-2-yl)amino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl] N-decan-2-ylcarbamate.
| Compound Name | [1-[(4-hydroxy-1-phenylbutan-2-yl)amino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl] N-decan-2-ylcarbamate |
|---|---|
| PubChem CID | 67828397 |
| Molecular Formula | C33H47N3O4 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | [1-[(4-hydroxy-1-phenylbutan-2-yl)amino]-3-(1H-indol-3-yl)-2-methyl-1-oxopropan-2-yl] N-decan-2-ylcarbamate |
| SMILES | CCCCCCCCC(C)NC(=O)OC(C)(Cc1c[nH]c2ccccc12)C(=O)NC(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C33H47N3O4/c1-4-5-6-7-8-10-15-25(2)35-32(39)40-33(3,23-27-24-34-30-19-14-13-18-29(27)30)31(38)36-28(20-21-37)22-26-16-11-9-12-17-26/h9,11-14,16-19,24-25,28,34,37H,4-8,10,15,20-23H2,1-3H3,(H,35,39)(H,36,38) |
| InChIKey | JALALPOVBIHCRL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|