C22H26N2O2 — CID 153378625
tert-butyl N-[1-(1H-indol-3-yl)-3-phenylpropan-2-yl]carbamate (PubChem CID 153378625) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl N-[1-(1H-indol-3-yl)-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(1H-indol-3-yl)-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 153378625 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl N-[1-(1H-indol-3-yl)-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H26N2O2/c1-22(2,3)26-21(25)24-18(13-16-9-5-4-6-10-16)14-17-15-23-20-12-8-7-11-19(17)20/h4-12,15,18,23H,13-14H2,1-3H3,(H,24,25) |
| InChIKey | BCMQDTCTNOTZAM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |