C20H27N3O4 — CID 140937778
prop-2-enyl N-[(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 140937778) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is prop-2-enyl N-[(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | prop-2-enyl N-[(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 140937778 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | prop-2-enyl N-[(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | C=CCOC(=O)NC[C@@H](Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27N3O4/c1-5-10-26-18(24)22-13-15(23-19(25)27-20(2,3)4)11-14-12-21-17-9-7-6-8-16(14)17/h5-9,12,15,21H,1,10-11,13H2,2-4H3,(H,22,24)(H,23,25)/t15-/m1/s1 |
| InChIKey | HRDNJYMXPWXUKR-OAHLLOKOSA-N |
| XLogP | 3.52 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|