C19H24N2O4 — CID 11210113
prop-2-enyl (2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 11210113) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | prop-2-enyl (2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 11210113 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | prop-2-enyl (2S)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24N2O4/c1-5-10-24-17(22)16(21-18(23)25-19(2,3)4)11-13-12-20-15-9-7-6-8-14(13)15/h5-9,12,16,20H,1,10-11H2,2-4H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | GWPGDAREFGYHSO-INIZCTEOSA-N |
| XLogP | 3.33 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|