C23H28N4O3 — CID 131720940
tert-butyl N-[(2S)-1-(2-benzylhydrazinyl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 131720940) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-benzylhydrazinyl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-benzylhydrazinyl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 131720940 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-benzylhydrazinyl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NNCc1ccccc1 |
| InChI | InChI=1S/C23H28N4O3/c1-23(2,3)30-22(29)26-20(13-17-15-24-19-12-8-7-11-18(17)19)21(28)27-25-14-16-9-5-4-6-10-16/h4-12,15,20,24-25H,13-14H2,1-3H3,(H,26,29)(H,27,28)/t20-/m0/s1 |
| InChIKey | ODHUQXFTBRVFMG-FQEVSTJZSA-N |
| XLogP | 3.42 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|