C23H28N2O2 — CID 175116528
tert-butyl N-[1-(7-methyl-1H-indol-3-yl)-3-phenylpropan-2-yl]carbamate (PubChem CID 175116528) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl N-[1-(7-methyl-1H-indol-3-yl)-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(7-methyl-1H-indol-3-yl)-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 175116528 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl N-[1-(7-methyl-1H-indol-3-yl)-3-phenylpropan-2-yl]carbamate |
| SMILES | Cc1cccc2c(CC(Cc3ccccc3)NC(=O)OC(C)(C)C)c[nH]c12 |
| InChI | InChI=1S/C23H28N2O2/c1-16-9-8-12-20-18(15-24-21(16)20)14-19(13-17-10-6-5-7-11-17)25-22(26)27-23(2,3)4/h5-12,15,19,24H,13-14H2,1-4H3,(H,25,26) |
| InChIKey | KBWMGFXBXOTZLO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |