C21H34N4O4 — CID 145005816
butanamide;tert-butyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formamide (PubChem CID 145005816) has the molecular formula C21H34N4O4 and a molecular weight of 406.53 g/mol. Its IUPAC name is butanamide;tert-butyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formamide.
| Compound Name | butanamide;tert-butyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formamide |
|---|---|
| PubChem CID | 145005816 |
| Molecular Formula | C21H34N4O4 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | butanamide;tert-butyl N-[1-(1H-indol-3-yl)propan-2-yl]carbamate;formamide |
| SMILES | CC(Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C.CCCC(N)=O.NC=O |
| InChI | InChI=1S/C16H22N2O2.C4H9NO.CH3NO/c1-11(18-15(19)20-16(2,3)4)9-12-10-17-14-8-6-5-7-13(12)14;1-2-3-4(5)6;2-1-3/h5-8,10-11,17H,9H2,1-4H3,(H,18,19);2-3H2,1H3,(H2,5,6);1H,(H2,2,3) |
| InChIKey | OQNUAPQAHZVJKU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|