C20H21N3O3 — CID 67599922
[2-(benzylamino)-1-(1H-indol-3-yl)-3-oxobutan-2-yl] carbamate (PubChem CID 67599922) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is [2-(benzylamino)-1-(1H-indol-3-yl)-3-oxobutan-2-yl] carbamate.
| Compound Name | [2-(benzylamino)-1-(1H-indol-3-yl)-3-oxobutan-2-yl] carbamate |
|---|---|
| PubChem CID | 67599922 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [2-(benzylamino)-1-(1H-indol-3-yl)-3-oxobutan-2-yl] carbamate |
| SMILES | CC(=O)C(Cc1c[nH]c2ccccc12)(NCc1ccccc1)OC(N)=O |
| InChI | InChI=1S/C20H21N3O3/c1-14(24)20(26-19(21)25,23-12-15-7-3-2-4-8-15)11-16-13-22-18-10-6-5-9-17(16)18/h2-10,13,22-23H,11-12H2,1H3,(H2,21,25) |
| InChIKey | IKDJJRIIRQENGH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|