C16H21N3O2S — CID 87622971
[(2R)-1-amino-2-(1H-indol-3-ylmethyl)-3,3-dimethyl-1-sulfanylidenebutan-2-yl] carbamate (PubChem CID 87622971) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is [(2R)-1-amino-2-(1H-indol-3-ylmethyl)-3,3-dimethyl-1-sulfanylidenebutan-2-yl] carbamate.
| Compound Name | [(2R)-1-amino-2-(1H-indol-3-ylmethyl)-3,3-dimethyl-1-sulfanylidenebutan-2-yl] carbamate |
|---|---|
| PubChem CID | 87622971 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [(2R)-1-amino-2-(1H-indol-3-ylmethyl)-3,3-dimethyl-1-sulfanylidenebutan-2-yl] carbamate |
| SMILES | CC(C)(C)[C@@](Cc1c[nH]c2ccccc12)(OC(N)=O)C(N)=S |
| InChI | InChI=1S/C16H21N3O2S/c1-15(2,3)16(13(17)22,21-14(18)20)8-10-9-19-12-7-5-4-6-11(10)12/h4-7,9,19H,8H2,1-3H3,(H2,17,22)(H2,18,20)/t16-/m0/s1 |
| InChIKey | RLBKZXXTRSCPNM-INIZCTEOSA-N |
| XLogP | 2.88 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|