C16H21NO2 — CID 170617478
tert-butyl (2S)-3-(1H-indol-3-yl)-2-methylpropanoate (PubChem CID 170617478) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is tert-butyl (2S)-3-(1H-indol-3-yl)-2-methylpropanoate.
| Compound Name | tert-butyl (2S)-3-(1H-indol-3-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 170617478 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | tert-butyl (2S)-3-(1H-indol-3-yl)-2-methylpropanoate |
| SMILES | C[C@@H](Cc1c[nH]c2ccccc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21NO2/c1-11(15(18)19-16(2,3)4)9-12-10-17-14-8-6-5-7-13(12)14/h5-8,10-11,17H,9H2,1-4H3/t11-/m0/s1 |
| InChIKey | OKBBHDMVZIJBKV-NSHDSACASA-N |
| XLogP | 3.69 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |