C16H23N3O2 — CID 150349077
tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate (PubChem CID 150349077) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate.
| Compound Name | tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 150349077 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate |
| SMILES | CC(C)(C)OC(=O)C(N)C(N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H23N3O2/c1-16(2,3)21-15(20)14(18)12(17)8-10-9-19-13-7-5-4-6-11(10)13/h4-7,9,12,14,19H,8,17-18H2,1-3H3 |
| InChIKey | GTIORGNJKDRWOG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |