tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate

C16H23N3O2 — CID 150349077

IUPACtert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate
SMILESCC(C)(C)OC(=O)C(N)C(N)Cc1c[nH]c2ccccc12
InChIInChI=1S/C16H23N3O2/c1-16(2,3)21-15(20)14(18)12(17)8-10-9-19-13-7-5-4-6-11(10)13/h4-7,9,12,14,19H,8,17-18H2,1-3H3
InChIKeyGTIORGNJKDRWOG-UHFFFAOYSA-N
MW289.38 g/mol
LogP1.71
Rot. Bonds4

About tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate

tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate (PubChem CID 150349077) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate.

Molecular Properties

Compound Nametert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate
PubChem CID150349077
Molecular FormulaC16H23N3O2
Molecular Weight289.38 g/mol
Exact Mass289.18
IUPAC Nametert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate
SMILESCC(C)(C)OC(=O)C(N)C(N)Cc1c[nH]c2ccccc12
InChIInChI=1S/C16H23N3O2/c1-16(2,3)21-15(20)14(18)12(17)8-10-9-19-13-7-5-4-6-11(10)13/h4-7,9,12,14,19H,8,17-18H2,1-3H3
InChIKeyGTIORGNJKDRWOG-UHFFFAOYSA-N
XLogP1.71
TPSA94.13 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.38
LogP ≤ 51.71
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate?
The IUPAC name of tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate (CID 150349077) is tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate.
What is the SMILES notation for tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate?
The canonical SMILES for tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate is CC(C)(C)OC(=O)C(N)C(N)Cc1c[nH]c2ccccc12.
What is the InChIKey of tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate?
The InChIKey is GTIORGNJKDRWOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O2/c1-16(2,3)21-15(20)14(18)12(17)8-10-9-19-13-7-5-4-6-11(10)13/h4-7,9,12,14,19H,8,17-18H2,1-3H3.
What are the key properties of tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate?
tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate has a molecular weight of 289.38 g/mol, XLogP of 1.71, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,3-diamino-4-(1H-indol-3-yl)butanoate is sourced from PubChem (CID 150349077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).