C22H27NO6 — CID 132525702
1-O-tert-butyl 3-O-[2-(2-methylprop-2-enoyloxy)ethyl] 2-(1H-indol-3-ylmethyl)propanedioate (PubChem CID 132525702) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-[2-(2-methylprop-2-enoyloxy)ethyl] 2-(1H-indol-3-ylmethyl)propanedioate.
| Compound Name | 1-O-tert-butyl 3-O-[2-(2-methylprop-2-enoyloxy)ethyl] 2-(1H-indol-3-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 132525702 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-O-tert-butyl 3-O-[2-(2-methylprop-2-enoyloxy)ethyl] 2-(1H-indol-3-ylmethyl)propanedioate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(Cc1c[nH]c2ccccc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27NO6/c1-14(2)19(24)27-10-11-28-20(25)17(21(26)29-22(3,4)5)12-15-13-23-18-9-7-6-8-16(15)18/h6-9,13,17,23H,1,10-12H2,2-5H3 |
| InChIKey | VTIFAEYLBLHDCV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|