C17H20N2O2 — CID 25135384
tert-butyl 2-cyano-4-(1H-indol-3-yl)butanoate (PubChem CID 25135384) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl 2-cyano-4-(1H-indol-3-yl)butanoate.
| Compound Name | tert-butyl 2-cyano-4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 25135384 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | tert-butyl 2-cyano-4-(1H-indol-3-yl)butanoate |
| SMILES | CC(C)(C)OC(=O)C(C#N)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H20N2O2/c1-17(2,3)21-16(20)12(10-18)8-9-13-11-19-15-7-5-4-6-14(13)15/h4-7,11-12,19H,8-9H2,1-3H3 |
| InChIKey | KAGNDYONMYTBNJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |