C21H30IN3O3 — CID 163827195
tert-butyl (2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-6-iodohexanoate (PubChem CID 163827195) has the molecular formula C21H30IN3O3 and a molecular weight of 499.39 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-6-iodohexanoate.
| Compound Name | tert-butyl (2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-6-iodohexanoate |
|---|---|
| PubChem CID | 163827195 |
| Molecular Formula | C21H30IN3O3 |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | tert-butyl (2S)-2-[[(2R)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]-6-iodohexanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCI)NC(=O)[C@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H30IN3O3/c1-21(2,3)28-20(27)18(10-6-7-11-22)25-19(26)16(23)12-14-13-24-17-9-5-4-8-15(14)17/h4-5,8-9,13,16,18,24H,6-7,10-12,23H2,1-3H3,(H,25,26)/t16-,18+/m1/s1 |
| InChIKey | OAMPTALTBHXPGL-AEFFLSMTSA-N |
| XLogP | 3.47 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|