C33H40N4O3 — CID 102020139
tert-butyl (2S)-6-amino-2-[[(2S)-3-(1H-indol-3-yl)-2-(4-phenylanilino)propanoyl]amino]hexanoate (PubChem CID 102020139) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is tert-butyl (2S)-6-amino-2-[[(2S)-3-(1H-indol-3-yl)-2-(4-phenylanilino)propanoyl]amino]hexanoate.
| Compound Name | tert-butyl (2S)-6-amino-2-[[(2S)-3-(1H-indol-3-yl)-2-(4-phenylanilino)propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 102020139 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | tert-butyl (2S)-6-amino-2-[[(2S)-3-(1H-indol-3-yl)-2-(4-phenylanilino)propanoyl]amino]hexanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1c[nH]c2ccccc12)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H40N4O3/c1-33(2,3)40-32(39)29(15-9-10-20-34)37-31(38)30(21-25-22-35-28-14-8-7-13-27(25)28)36-26-18-16-24(17-19-26)23-11-5-4-6-12-23/h4-8,11-14,16-19,22,29-30,35-36H,9-10,15,20-21,34H2,1-3H3,(H,37,38)/t29-,30-/m0/s1 |
| InChIKey | XGVCLWQZHMVIQE-KYJUHHDHSA-N |
| XLogP | 5.81 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|