C30H32N4O4 — CID 18379932
6-amino-2-[[3-(1H-indol-3-yl)-2-[(4-phenylbenzoyl)amino]propanoyl]amino]hexanoic acid (PubChem CID 18379932) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is 6-amino-2-[[3-(1H-indol-3-yl)-2-[(4-phenylbenzoyl)amino]propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[3-(1H-indol-3-yl)-2-[(4-phenylbenzoyl)amino]propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18379932 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 6-amino-2-[[3-(1H-indol-3-yl)-2-[(4-phenylbenzoyl)amino]propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)c1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H32N4O4/c31-17-7-6-12-26(30(37)38)33-29(36)27(18-23-19-32-25-11-5-4-10-24(23)25)34-28(35)22-15-13-21(14-16-22)20-8-2-1-3-9-20/h1-5,8-11,13-16,19,26-27,32H,6-7,12,17-18,31H2,(H,33,36)(H,34,35)(H,37,38) |
| InChIKey | MNMNIDFTPCNGAE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|