C25H31N5O4 — CID 175692414
(2S)-6-amino-2-[[(2R)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid (PubChem CID 175692414) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175692414 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-2-[[(2S)-2-amino-2-phenylacetyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H31N5O4/c26-13-7-6-12-20(25(33)34)29-23(31)21(14-17-15-28-19-11-5-4-10-18(17)19)30-24(32)22(27)16-8-2-1-3-9-16/h1-5,8-11,15,20-22,28H,6-7,12-14,26-27H2,(H,29,31)(H,30,32)(H,33,34)/t20-,21+,22-/m0/s1 |
| InChIKey | WFAHDWGXQHDVCS-BDTNDASRSA-N |
| XLogP | 1.59 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|