C17H25N3O — CID 103827503
(2S)-2-amino-N-(3,3-dimethylbutan-2-yl)-3-(1H-indol-3-yl)propanamide (PubChem CID 103827503) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,3-dimethylbutan-2-yl)-3-(1H-indol-3-yl)propanamide.
| Compound Name | (2S)-2-amino-N-(3,3-dimethylbutan-2-yl)-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 103827503 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (2S)-2-amino-N-(3,3-dimethylbutan-2-yl)-3-(1H-indol-3-yl)propanamide |
| SMILES | CC(NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C17H25N3O/c1-11(17(2,3)4)20-16(21)14(18)9-12-10-19-15-8-6-5-7-13(12)15/h5-8,10-11,14,19H,9,18H2,1-4H3,(H,20,21)/t11?,14-/m0/s1 |
| InChIKey | HZLUFEBVFMOBCZ-IAXJKZSUSA-N |
| XLogP | 2.59 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |