C16H24N4O — CID 104910967
(2R)-2-amino-N-[1-(dimethylamino)propan-2-yl]-3-(1H-indol-3-yl)propanamide (PubChem CID 104910967) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is (2R)-2-amino-N-[1-(dimethylamino)propan-2-yl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | (2R)-2-amino-N-[1-(dimethylamino)propan-2-yl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 104910967 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (2R)-2-amino-N-[1-(dimethylamino)propan-2-yl]-3-(1H-indol-3-yl)propanamide |
| SMILES | CC(CN(C)C)NC(=O)[C@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H24N4O/c1-11(10-20(2)3)19-16(21)14(17)8-12-9-18-15-7-5-4-6-13(12)15/h4-7,9,11,14,18H,8,10,17H2,1-3H3,(H,19,21)/t11?,14-/m1/s1 |
| InChIKey | VXQNKMBQIAFONL-SBXXRYSUSA-N |
| XLogP | 1.10 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |