C20H23N3O — CID 119956347
(2S)-2-amino-3-(1H-indol-3-yl)-N-[1-(4-methylphenyl)ethyl]propanamide (PubChem CID 119956347) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)-N-[1-(4-methylphenyl)ethyl]propanamide.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[1-(4-methylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 119956347 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[1-(4-methylphenyl)ethyl]propanamide |
| SMILES | Cc1ccc(C(C)NC(=O)[C@@H](N)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C20H23N3O/c1-13-7-9-15(10-8-13)14(2)23-20(24)18(21)11-16-12-22-19-6-4-3-5-17(16)19/h3-10,12,14,18,22H,11,21H2,1-2H3,(H,23,24)/t14?,18-/m0/s1 |
| InChIKey | WLUBZZXSSXTMIB-IBYPIGCZSA-N |
| XLogP | 3.22 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |