C20H31NO3Si — CID 172551958
methyl 2-[tert-butyl(dimethyl)silyl]oxy-5-(1H-indol-3-yl)pentanoate (PubChem CID 172551958) has the molecular formula C20H31NO3Si and a molecular weight of 361.56 g/mol. Its IUPAC name is methyl 2-[tert-butyl(dimethyl)silyl]oxy-5-(1H-indol-3-yl)pentanoate.
| Compound Name | methyl 2-[tert-butyl(dimethyl)silyl]oxy-5-(1H-indol-3-yl)pentanoate |
|---|---|
| PubChem CID | 172551958 |
| Molecular Formula | C20H31NO3Si |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | methyl 2-[tert-butyl(dimethyl)silyl]oxy-5-(1H-indol-3-yl)pentanoate |
| SMILES | COC(=O)C(CCCc1c[nH]c2ccccc12)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H31NO3Si/c1-20(2,3)25(5,6)24-18(19(22)23-4)13-9-10-15-14-21-17-12-8-7-11-16(15)17/h7-8,11-12,14,18,21H,9-10,13H2,1-6H3 |
| InChIKey | YRSOSLRPGGQWJC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|