C12H15ClN2O2 — CID 2737346
[3-(1H-indol-3-yl)-1-methoxy-1-oxopropan-2-yl]azanium chloride (PubChem CID 2737346) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is [3-(1H-indol-3-yl)-1-methoxy-1-oxopropan-2-yl]azanium chloride.
| Compound Name | [3-(1H-indol-3-yl)-1-methoxy-1-oxopropan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 2737346 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | [3-(1H-indol-3-yl)-1-methoxy-1-oxopropan-2-yl]azanium chloride |
| SMILES | COC(=O)C([NH3+])Cc1c[nH]c2ccccc12.[Cl-] |
| InChI | InChI=1S/C12H14N2O2.ClH/c1-16-12(15)10(13)6-8-7-14-11-5-3-2-4-9(8)11;/h2-5,7,10,14H,6,13H2,1H3;1H |
| InChIKey | XNFNGGQRDXFYMM-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |