C13H18ClN3O2 — CID 10708151
[(2S)-1-(2-hydroxyethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]azanium chloride (PubChem CID 10708151) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is [(2S)-1-(2-hydroxyethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]azanium chloride.
| Compound Name | [(2S)-1-(2-hydroxyethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 10708151 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | [(2S)-1-(2-hydroxyethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]azanium chloride |
| SMILES | [Cl-].[NH3+][C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCO |
| InChI | InChI=1S/C13H17N3O2.ClH/c14-11(13(18)15-5-6-17)7-9-8-16-12-4-2-1-3-10(9)12;/h1-4,8,11,16-17H,5-7,14H2,(H,15,18);1H/t11-;/m0./s1 |
| InChIKey | MQMYMGRFOCNQHF-MERQFXBCSA-N |
| XLogP | -3.57 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |