C19H26N2O4 — CID 160543716
tert-butyl (3S)-4-(2-hydroxyethylamino)-3-(1H-indol-3-ylmethyl)-4-oxobutanoate (PubChem CID 160543716) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl (3S)-4-(2-hydroxyethylamino)-3-(1H-indol-3-ylmethyl)-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-4-(2-hydroxyethylamino)-3-(1H-indol-3-ylmethyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 160543716 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | tert-butyl (3S)-4-(2-hydroxyethylamino)-3-(1H-indol-3-ylmethyl)-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](Cc1c[nH]c2ccccc12)C(=O)NCCO |
| InChI | InChI=1S/C19H26N2O4/c1-19(2,3)25-17(23)11-13(18(24)20-8-9-22)10-14-12-21-16-7-5-4-6-15(14)16/h4-7,12-13,21-22H,8-11H2,1-3H3,(H,20,24)/t13-/m0/s1 |
| InChIKey | QXDGWYGQCIPNIL-ZDUSSCGKSA-N |
| XLogP | 2.17 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |