C21H25ClN4O3 — CID 10788093
[(2S)-3-(1H-indol-3-yl)-1-oxo-1-[2-(phenylmethoxycarbonylamino)ethylamino]propan-2-yl]azanium chloride (PubChem CID 10788093) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is [(2S)-3-(1H-indol-3-yl)-1-oxo-1-[2-(phenylmethoxycarbonylamino)ethylamino]propan-2-yl]azanium chloride.
| Compound Name | [(2S)-3-(1H-indol-3-yl)-1-oxo-1-[2-(phenylmethoxycarbonylamino)ethylamino]propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 10788093 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [(2S)-3-(1H-indol-3-yl)-1-oxo-1-[2-(phenylmethoxycarbonylamino)ethylamino]propan-2-yl]azanium chloride |
| SMILES | [Cl-].[NH3+][C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H24N4O3.ClH/c22-18(12-16-13-25-19-9-5-4-8-17(16)19)20(26)23-10-11-24-21(27)28-14-15-6-2-1-3-7-15;/h1-9,13,18,25H,10-12,14,22H2,(H,23,26)(H,24,27);1H/t18-;/m0./s1 |
| InChIKey | UYUZWPNMIQLZMH-FERBBOLQSA-N |
| XLogP | -1.63 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|