C30H38N4O6 — CID 58248645
benzyl N-[4-[[(2S)-1-[(7-hydroxy-6-oxoheptyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutyl]carbamate (PubChem CID 58248645) has the molecular formula C30H38N4O6 and a molecular weight of 550.66 g/mol. Its IUPAC name is benzyl N-[4-[[(2S)-1-[(7-hydroxy-6-oxoheptyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[(2S)-1-[(7-hydroxy-6-oxoheptyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 58248645 |
| Molecular Formula | C30H38N4O6 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | benzyl N-[4-[[(2S)-1-[(7-hydroxy-6-oxoheptyl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutyl]carbamate |
| SMILES | O=C(CO)CCCCCNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H38N4O6/c35-20-24(36)12-5-2-8-16-31-29(38)27(18-23-19-33-26-14-7-6-13-25(23)26)34-28(37)15-9-17-32-30(39)40-21-22-10-3-1-4-11-22/h1,3-4,6-7,10-11,13-14,19,27,33,35H,2,5,8-9,12,15-18,20-21H2,(H,31,38)(H,32,39)(H,34,37)/t27-/m0/s1 |
| InChIKey | XTTLYPLQZTUMGM-MHZLTWQESA-N |
| XLogP | 3.14 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|