C39H49N5O6 — CID 58731562
benzyl N-[5-[[(2S)-3-(1H-indol-3-yl)-2-[[(2R)-4-methyl-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoyl]amino]propanoyl]amino]pentyl]carbamate (PubChem CID 58731562) has the molecular formula C39H49N5O6 and a molecular weight of 683.85 g/mol. Its IUPAC name is benzyl N-[5-[[(2S)-3-(1H-indol-3-yl)-2-[[(2R)-4-methyl-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoyl]amino]propanoyl]amino]pentyl]carbamate.
| Compound Name | benzyl N-[5-[[(2S)-3-(1H-indol-3-yl)-2-[[(2R)-4-methyl-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoyl]amino]propanoyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 58731562 |
| Molecular Formula | C39H49N5O6 |
| Molecular Weight | 683.85 g/mol |
| Exact Mass | 683.37 |
| IUPAC Name | benzyl N-[5-[[(2S)-3-(1H-indol-3-yl)-2-[[(2R)-4-methyl-2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoyl]amino]propanoyl]amino]pentyl]carbamate |
| SMILES | CC(C)C[C@H](CC(=O)NOCc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C39H49N5O6/c1-28(2)22-31(24-36(45)44-50-27-30-16-8-4-9-17-30)37(46)43-35(23-32-25-42-34-19-11-10-18-33(32)34)38(47)40-20-12-5-13-21-41-39(48)49-26-29-14-6-3-7-15-29/h3-4,6-11,14-19,25,28,31,35,42H,5,12-13,20-24,26-27H2,1-2H3,(H,40,47)(H,41,48)(H,43,46)(H,44,45)/t31-,35+/m1/s1 |
| InChIKey | JLLHKMISYJKWQP-NQVJXQQZSA-N |
| XLogP | 5.71 |
| TPSA | 150.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.85 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|