C26H39N5O5 — CID 59439618
CID 59439618 (PubChem CID 59439618) has the molecular formula C26H39N5O5 and a molecular weight of 501.63 g/mol.
| Compound Name | CID 59439618 |
|---|---|
| PubChem CID | 59439618 |
| Molecular Formula | C26H39N5O5 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | — |
| SMILES | [CH]NCCCOCCCNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)[C@@H](CC(=O)NO)CC(C)C |
| InChI | InChI=1S/C26H39N5O5/c1-18(2)14-19(16-24(32)31-35)25(33)30-23(15-20-17-29-22-9-5-4-8-21(20)22)26(34)28-11-7-13-36-12-6-10-27-3/h3-5,8-9,17-19,23,27,29,35H,6-7,10-16H2,1-2H3,(H,28,34)(H,30,33)(H,31,32)/t19-,23?/m1/s1 |
| InChIKey | GCGCMOZKKOPOFQ-HWYAHNCWSA-N |
| XLogP | 1.92 |
| TPSA | 144.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|