C23H32N4O6 — CID 10647658
methyl 2-[[(3R)-3-[[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-5-methylhexanoyl]amino]oxyacetate (PubChem CID 10647658) has the molecular formula C23H32N4O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is methyl 2-[[(3R)-3-[[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-5-methylhexanoyl]amino]oxyacetate.
| Compound Name | methyl 2-[[(3R)-3-[[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-5-methylhexanoyl]amino]oxyacetate |
|---|---|
| PubChem CID | 10647658 |
| Molecular Formula | C23H32N4O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | methyl 2-[[(3R)-3-[[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-5-methylhexanoyl]amino]oxyacetate |
| SMILES | CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](CC(=O)NOCC(=O)OC)CC(C)C |
| InChI | InChI=1S/C23H32N4O6/c1-14(2)9-15(11-20(28)27-33-13-21(29)32-4)22(30)26-19(23(31)24-3)10-16-12-25-18-8-6-5-7-17(16)18/h5-8,12,14-15,19,25H,9-11,13H2,1-4H3,(H,24,31)(H,26,30)(H,27,28)/t15-,19+/m1/s1 |
| InChIKey | BAYJYFFPKRGRAF-BEFAXECRSA-N |
| XLogP | 1.21 |
| TPSA | 138.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|