C20H28N4O5S2 — CID 162427190
2-[[1-[[3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]sulfamoyl]ethanethioic S-acid (PubChem CID 162427190) has the molecular formula C20H28N4O5S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-[[1-[[3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]sulfamoyl]ethanethioic S-acid.
| Compound Name | 2-[[1-[[3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]sulfamoyl]ethanethioic S-acid |
|---|---|
| PubChem CID | 162427190 |
| Molecular Formula | C20H28N4O5S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[[1-[[3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]sulfamoyl]ethanethioic S-acid |
| SMILES | CNC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CC(C)C)NS(=O)(=O)CC(=O)S |
| InChI | InChI=1S/C20H28N4O5S2/c1-12(2)8-17(24-31(28,29)11-18(25)30)20(27)23-16(19(26)21-3)9-13-10-22-15-7-5-4-6-14(13)15/h4-7,10,12,16-17,22,24H,8-9,11H2,1-3H3,(H,21,26)(H,23,27)(H,25,30) |
| InChIKey | DYFDHDCNGHXKPW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|