C23H30BN3O5S — CID 165382079
[(1R)-1-[[(2S)-2-(benzylsulfonylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 165382079) has the molecular formula C23H30BN3O5S and a molecular weight of 471.39 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-(benzylsulfonylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-(benzylsulfonylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 165382079 |
| Molecular Formula | C23H30BN3O5S |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | [(1R)-1-[[(2S)-2-(benzylsulfonylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NS(=O)(=O)Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C23H30BN3O5S/c1-16(2)12-22(24(29)30)26-23(28)21(13-18-14-25-20-11-7-6-10-19(18)20)27-33(31,32)15-17-8-4-3-5-9-17/h3-11,14,16,21-22,25,27,29-30H,12-13,15H2,1-2H3,(H,26,28)/t21-,22-/m0/s1 |
| InChIKey | XUIDJXCVXNTDND-VXKWHMMOSA-N |
| XLogP | 1.74 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|