C25H31BN2O5 — CID 167613726
[(1R)-1-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxo-4-phenylmethoxybutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 167613726) has the molecular formula C25H31BN2O5 and a molecular weight of 450.34 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxo-4-phenylmethoxybutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxo-4-phenylmethoxybutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 167613726 |
| Molecular Formula | C25H31BN2O5 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(1R)-1-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxo-4-phenylmethoxybutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)OCc1ccccc1)Cc1c[nH]c2ccccc12)B(O)O |
| InChI | InChI=1S/C25H31BN2O5/c1-17(2)12-23(26(31)32)28-25(30)19(13-20-15-27-22-11-7-6-10-21(20)22)14-24(29)33-16-18-8-4-3-5-9-18/h3-11,15,17,19,23,27,31-32H,12-14,16H2,1-2H3,(H,28,30)/t19-,23+/m1/s1 |
| InChIKey | LKWHKISJEKLBSQ-XXBNENTESA-N |
| XLogP | 3.00 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|