C27H30BN3O4 — CID 167585719
[(1R)-1-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxo-4-quinolin-6-ylbutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 167585719) has the molecular formula C27H30BN3O4 and a molecular weight of 471.37 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxo-4-quinolin-6-ylbutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxo-4-quinolin-6-ylbutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 167585719 |
| Molecular Formula | C27H30BN3O4 |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | [(1R)-1-[[(2R)-2-(1H-indol-3-ylmethyl)-4-oxo-4-quinolin-6-ylbutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)c1ccc2ncccc2c1)Cc1c[nH]c2ccccc12)B(O)O |
| InChI | InChI=1S/C27H30BN3O4/c1-17(2)12-26(28(34)35)31-27(33)20(14-21-16-30-24-8-4-3-7-22(21)24)15-25(32)19-9-10-23-18(13-19)6-5-11-29-23/h3-11,13,16-17,20,26,30,34-35H,12,14-15H2,1-2H3,(H,31,33)/t20-,26+/m1/s1 |
| InChIKey | HTTBCXYOYBWJCQ-IBVKSMDESA-N |
| XLogP | 3.69 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|