C26H27N5O3 — CID 4292722
tert-butyl N-[3-(1H-indol-3-yl)-1-oxo-1-[2-(quinolin-6-ylmethylidene)hydrazinyl]propan-2-yl]carbamate (PubChem CID 4292722) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is tert-butyl N-[3-(1H-indol-3-yl)-1-oxo-1-[2-(quinolin-6-ylmethylidene)hydrazinyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(1H-indol-3-yl)-1-oxo-1-[2-(quinolin-6-ylmethylidene)hydrazinyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 4292722 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | tert-butyl N-[3-(1H-indol-3-yl)-1-oxo-1-[2-(quinolin-6-ylmethylidene)hydrazinyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NN=Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C26H27N5O3/c1-26(2,3)34-25(33)30-23(14-19-16-28-22-9-5-4-8-20(19)22)24(32)31-29-15-17-10-11-21-18(13-17)7-6-12-27-21/h4-13,15-16,23,28H,14H2,1-3H3,(H,30,33)(H,31,32) |
| InChIKey | SWOIQTXTMCAPFH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|