C22H26N6O5 — CID 136888581
tert-butyl N-[(2S)-3-(1H-indol-3-yl)-1-[(2Z)-2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 136888581) has the molecular formula C22H26N6O5 and a molecular weight of 454.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-(1H-indol-3-yl)-1-[(2Z)-2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-(1H-indol-3-yl)-1-[(2Z)-2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 136888581 |
| Molecular Formula | C22H26N6O5 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | tert-butyl N-[(2S)-3-(1H-indol-3-yl)-1-[(2Z)-2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1/C=N\NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H26N6O5/c1-12-15(18(29)27-20(31)25-12)11-24-28-19(30)17(26-21(32)33-22(2,3)4)9-13-10-23-16-8-6-5-7-14(13)16/h5-8,10-11,17,23H,9H2,1-4H3,(H,26,32)(H,28,30)(H2,25,27,29,31)/b24-11-/t17-/m0/s1 |
| InChIKey | MGDMCZJTCUKKDW-GQJRVPCCSA-N |
| XLogP | 1.44 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|