C31H37N5O5S — CID 54141469
(2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-N-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]-4-methylpentanamide (PubChem CID 54141469) has the molecular formula C31H37N5O5S and a molecular weight of 591.73 g/mol. Its IUPAC name is (2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-N-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-N-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 54141469 |
| Molecular Formula | C31H37N5O5S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | (2S)-2-[[5-(1,3-dioxoisoindol-2-yl)-2-sulfanylpentanoyl]amino]-N-[(2S)-3-(1H-indol-3-yl)-1-(methylamino)-1-oxopropan-2-yl]-4-methylpentanamide |
| SMILES | CNC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)C(S)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C31H37N5O5S/c1-18(2)15-24(28(38)34-25(27(37)32-3)16-19-17-33-23-12-7-6-9-20(19)23)35-29(39)26(42)13-8-14-36-30(40)21-10-4-5-11-22(21)31(36)41/h4-7,9-12,17-18,24-26,33,42H,8,13-16H2,1-3H3,(H,32,37)(H,34,38)(H,35,39)/t24-,25-,26?/m0/s1 |
| InChIKey | OBJZLKHKVMKAEA-NPGWBMRXSA-N |
| XLogP | 2.85 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|