C21H26N2O6S — CID 56996659
(2S)-2-[[(2R)-2-acetylsulfanyl-5-(1,3-dioxoisoindol-2-yl)pentanoyl]amino]-4-methylpentanoic acid (PubChem CID 56996659) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-acetylsulfanyl-5-(1,3-dioxoisoindol-2-yl)pentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-acetylsulfanyl-5-(1,3-dioxoisoindol-2-yl)pentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 56996659 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (2S)-2-[[(2R)-2-acetylsulfanyl-5-(1,3-dioxoisoindol-2-yl)pentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(=O)S[C@H](CCCN1C(=O)c2ccccc2C1=O)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C21H26N2O6S/c1-12(2)11-16(21(28)29)22-18(25)17(30-13(3)24)9-6-10-23-19(26)14-7-4-5-8-15(14)20(23)27/h4-5,7-8,12,16-17H,6,9-11H2,1-3H3,(H,22,25)(H,28,29)/t16-,17+/m0/s1 |
| InChIKey | ZNRDNRKGRDESQQ-DLBZAZTESA-N |
| XLogP | 2.33 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|