C26H34N2O3S — CID 10182676
S-[1-[[4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl] ethanethioate (PubChem CID 10182676) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is S-[1-[[4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl] ethanethioate.
| Compound Name | S-[1-[[4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl] ethanethioate |
|---|---|
| PubChem CID | 10182676 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | S-[1-[[4-methyl-1-oxo-1-(2-phenylethylamino)pentan-2-yl]amino]-1-oxo-4-phenylbutan-2-yl] ethanethioate |
| SMILES | CC(=O)SC(CCc1ccccc1)C(=O)NC(CC(C)C)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C26H34N2O3S/c1-19(2)18-23(25(30)27-17-16-22-12-8-5-9-13-22)28-26(31)24(32-20(3)29)15-14-21-10-6-4-7-11-21/h4-13,19,23-24H,14-18H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | OFAJQRPNZMOHGV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|