C23H36N4O4S — CID 18395614
(2S)-2-[(5-acetamido-2-sulfanylpentanoyl)amino]-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide (PubChem CID 18395614) has the molecular formula C23H36N4O4S and a molecular weight of 464.63 g/mol. Its IUPAC name is (2S)-2-[(5-acetamido-2-sulfanylpentanoyl)amino]-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide.
| Compound Name | (2S)-2-[(5-acetamido-2-sulfanylpentanoyl)amino]-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 18395614 |
| Molecular Formula | C23H36N4O4S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (2S)-2-[(5-acetamido-2-sulfanylpentanoyl)amino]-4-methyl-N-[(2S)-1-(methylamino)-1-oxo-3-phenylpropan-2-yl]pentanamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(C)C)NC(=O)C(S)CCCNC(C)=O |
| InChI | InChI=1S/C23H36N4O4S/c1-15(2)13-18(27-23(31)20(32)11-8-12-25-16(3)28)22(30)26-19(21(29)24-4)14-17-9-6-5-7-10-17/h5-7,9-10,15,18-20,32H,8,11-14H2,1-4H3,(H,24,29)(H,25,28)(H,26,30)(H,27,31)/t18-,19-,20?/m0/s1 |
| InChIKey | GQRJXOQFLWQRGA-NFBCFJMWSA-N |
| XLogP | 1.21 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|